C13H15ClFNO — CID 91007247
(1S,2S,3S)-3-(2-chloro-4-fluorophenyl)-8-azabicyclo[3.2.1]octan-2-ol (PubChem CID 91007247) has the molecular formula C13H15ClFNO and a molecular weight of 255.72 g/mol. Its IUPAC name is (1S,2S,3S)-3-(2-chloro-4-fluorophenyl)-8-azabicyclo[3.2.1]octan-2-ol.
| Compound Name | (1S,2S,3S)-3-(2-chloro-4-fluorophenyl)-8-azabicyclo[3.2.1]octan-2-ol |
|---|---|
| PubChem CID | 91007247 |
| Molecular Formula | C13H15ClFNO |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (1S,2S,3S)-3-(2-chloro-4-fluorophenyl)-8-azabicyclo[3.2.1]octan-2-ol |
| SMILES | O[C@@H]1[C@@H]2CCC(C[C@H]1c1ccc(F)cc1Cl)N2 |
| InChI | InChI=1S/C13H15ClFNO/c14-11-5-7(15)1-3-9(11)10-6-8-2-4-12(16-8)13(10)17/h1,3,5,8,10,12-13,16-17H,2,4,6H2/t8?,10-,12-,13-/m0/s1 |
| InChIKey | FLSXUGNJDLLSIJ-RNUNJCBPSA-N |
| XLogP | 2.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |