About 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine
6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine (PubChem CID 91008358) has the molecular formula C10H19N5
and a molecular weight of 209.30 g/mol. Its IUPAC name is 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine.
Molecular Properties
| Compound Name | 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine |
| PubChem CID | 91008358 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine |
| SMILES | [H]/N=C1\CC=CC(C2CNCCN2C)N1N |
| InChI | InChI=1S/C10H19N5/c1-14-6-5-13-7-9(14)8-3-2-4-10(11)15(8)12/h2-3,8-9,11,13H,4-7,12H2,1H3/b11-10+ |
| InChIKey | QQPHAQSXNRYIAK-ZHACJKMWSA-N |
| XLogP | -0.63 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine?
The IUPAC name of 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine (CID 91008358) is 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine.
What is the SMILES notation for 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine?
The canonical SMILES for 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine is [H]/N=C1\CC=CC(C2CNCCN2C)N1N.
What is the InChIKey of 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine?
The InChIKey is QQPHAQSXNRYIAK-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H19N5/c1-14-6-5-13-7-9(14)8-3-2-4-10(11)15(8)12/h2-3,8-9,11,13H,4-7,12H2,1H3/b11-10+.
What are the key properties of 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine?
6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine has a molecular weight of 209.30 g/mol, XLogP of -0.63, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-2-(1-methylpiperazin-2-yl)-2,5-dihydropyridin-1-amine is sourced from PubChem (CID 91008358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).