C52H50 — CID 91008385
1-(6,7-diethynylnaphthalen-1-yl)-3-[3-(6,7-diethynylnaphthalen-1-yl)-5,7-dimethyl-1-adamantyl]-5,7-dimethyladamantane (PubChem CID 91008385) has the molecular formula C52H50 and a molecular weight of 674.97 g/mol. Its IUPAC name is 1-(6,7-diethynylnaphthalen-1-yl)-3-[3-(6,7-diethynylnaphthalen-1-yl)-5,7-dimethyl-1-adamantyl]-5,7-dimethyladamantane.
| Compound Name | 1-(6,7-diethynylnaphthalen-1-yl)-3-[3-(6,7-diethynylnaphthalen-1-yl)-5,7-dimethyl-1-adamantyl]-5,7-dimethyladamantane |
|---|---|
| PubChem CID | 91008385 |
| Molecular Formula | C52H50 |
| Molecular Weight | 674.97 g/mol |
| Exact Mass | 674.39 |
| IUPAC Name | 1-(6,7-diethynylnaphthalen-1-yl)-3-[3-(6,7-diethynylnaphthalen-1-yl)-5,7-dimethyl-1-adamantyl]-5,7-dimethyladamantane |
| SMILES | C#Cc1cc2cccc(C34CC5(C)CC(C)(C3)CC(C36CC7(C)CC(C)(CC(c8cccc9cc(C#C)c(C#C)cc89)(C7)C3)C6)(C5)C4)c2cc1C#C |
| InChI | InChI=1S/C52H50/c1-9-35-19-39-15-13-17-43(41(39)21-37(35)11-3)49-25-45(5)23-46(6,26-49)30-51(29-45,33-49)52-31-47(7)24-48(8,32-52)28-50(27-47,34-52)44-18-14-16-40-20-36(10-2)38(12-4)22-42(40)44/h1-4,13-22H,23-34H2,5-8H3 |
| InChIKey | OYBOICHSUBEWCA-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.97 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|