C26H29NO6 — CID 91008710
tert-butyl N-[1-[2,4-dioxo-5-(2-phenylethyl)oxolan-3-yl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 91008710) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is tert-butyl N-[1-[2,4-dioxo-5-(2-phenylethyl)oxolan-3-yl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2,4-dioxo-5-(2-phenylethyl)oxolan-3-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 91008710 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | tert-butyl N-[1-[2,4-dioxo-5-(2-phenylethyl)oxolan-3-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)C1C(=O)OC(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H29NO6/c1-26(2,3)33-25(31)27-19(16-18-12-8-5-9-13-18)22(28)21-23(29)20(32-24(21)30)15-14-17-10-6-4-7-11-17/h4-13,19-21H,14-16H2,1-3H3,(H,27,31) |
| InChIKey | NBSRXETXQPQFGQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|