C4H4Cl5I — CID 91009400
1,1,1,2,2-pentachloro-3-iodobutane (PubChem CID 91009400) has the molecular formula C4H4Cl5I and a molecular weight of 356.25 g/mol. Its IUPAC name is 1,1,1,2,2-pentachloro-3-iodobutane.
| Compound Name | 1,1,1,2,2-pentachloro-3-iodobutane |
|---|---|
| PubChem CID | 91009400 |
| Molecular Formula | C4H4Cl5I |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 353.78 |
| IUPAC Name | 1,1,1,2,2-pentachloro-3-iodobutane |
| SMILES | CC(I)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H4Cl5I/c1-2(10)3(5,6)4(7,8)9/h2H,1H3 |
| InChIKey | HTMKIBXDNUGHRV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|