C6H9N — CID 91009510
N-penta-2,4-dien-2-ylmethanimine (PubChem CID 91009510) has the molecular formula C6H9N and a molecular weight of 95.14 g/mol. Its IUPAC name is N-penta-2,4-dien-2-ylmethanimine.
| Compound Name | N-penta-2,4-dien-2-ylmethanimine |
|---|---|
| PubChem CID | 91009510 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.14 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | N-penta-2,4-dien-2-ylmethanimine |
| SMILES | C=CC=C(C)N=C |
| InChI | InChI=1S/C6H9N/c1-4-5-6(2)7-3/h4-5H,1,3H2,2H3 |
| InChIKey | LASOAXSAOZKSMF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.14 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|