About [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium
[(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium (PubChem CID 91009617) has the molecular formula C8H13F3N2P+
and a molecular weight of 225.17 g/mol. Its IUPAC name is [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium.
Molecular Properties
| Compound Name | [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium |
| PubChem CID | 91009617 |
| Molecular Formula | C8H13F3N2P+ |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium |
| SMILES | C=[P+](C)CNC(C#N)CCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2P/c1-14(2)6-13-7(5-12)3-4-8(9,10)11/h7,13H,1,3-4,6H2,2H3/q+1 |
| InChIKey | XPWZAFWEFXRQGQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium?
The IUPAC name of [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium (CID 91009617) is [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium.
What is the SMILES notation for [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium?
The canonical SMILES for [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium is C=[P+](C)CNC(C#N)CCC(F)(F)F.
What is the InChIKey of [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium?
The InChIKey is XPWZAFWEFXRQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2P/c1-14(2)6-13-7(5-12)3-4-8(9,10)11/h7,13H,1,3-4,6H2,2H3/q+1.
What are the key properties of [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium?
[(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium has a molecular weight of 225.17 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-cyano-4,4,4-trifluorobutyl)amino]methyl-methyl-methylidenephosphanium is sourced from PubChem (CID 91009617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).