C20H28O2 — CID 91009619
4-methyl-6-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-2H-pyran-2-ol (PubChem CID 91009619) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 4-methyl-6-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-2H-pyran-2-ol.
| Compound Name | 4-methyl-6-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-2H-pyran-2-ol |
|---|---|
| PubChem CID | 91009619 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 4-methyl-6-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-2H-pyran-2-ol |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC1=CC(C)=CC(O)O1 |
| InChI | InChI=1S/C20H28O2/c1-14(11-17-12-15(2)13-19(21)22-17)8-9-18-16(3)7-6-10-20(18,4)5/h8-9,11-13,19,21H,6-7,10H2,1-5H3 |
| InChIKey | BPLDWXRCCMUZAK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|