C19H20O5 — CID 91009858
7-(hydroxymethyl)-6-methoxy-1,1,4a-trimethyl-10aH-phenanthrene-2,9,10-trione (PubChem CID 91009858) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is 7-(hydroxymethyl)-6-methoxy-1,1,4a-trimethyl-10aH-phenanthrene-2,9,10-trione.
| Compound Name | 7-(hydroxymethyl)-6-methoxy-1,1,4a-trimethyl-10aH-phenanthrene-2,9,10-trione |
|---|---|
| PubChem CID | 91009858 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 7-(hydroxymethyl)-6-methoxy-1,1,4a-trimethyl-10aH-phenanthrene-2,9,10-trione |
| SMILES | COc1cc2c(cc1CO)C(=O)C(=O)C1C(C)(C)C(=O)C=CC21C |
| InChI | InChI=1S/C19H20O5/c1-18(2)14(21)5-6-19(3)12-8-13(24-4)10(9-20)7-11(12)15(22)16(23)17(18)19/h5-8,17,20H,9H2,1-4H3 |
| InChIKey | UIJJFWWNNYEAPB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|