C25H32F3N2O3S+ — CID 91010066
2-[[3-[[2-[(2,4-dimethyl-1,1-dioxothiazetidin-2-ium-2-yl)methyl]-2,3-dihydro-1H-inden-5-yl]methyl]-5-(trifluoromethyl)phenyl]methylamino]ethanol (PubChem CID 91010066) has the molecular formula C25H32F3N2O3S+ and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-[[3-[[2-[(2,4-dimethyl-1,1-dioxothiazetidin-2-ium-2-yl)methyl]-2,3-dihydro-1H-inden-5-yl]methyl]-5-(trifluoromethyl)phenyl]methylamino]ethanol.
| Compound Name | 2-[[3-[[2-[(2,4-dimethyl-1,1-dioxothiazetidin-2-ium-2-yl)methyl]-2,3-dihydro-1H-inden-5-yl]methyl]-5-(trifluoromethyl)phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 91010066 |
| Molecular Formula | C25H32F3N2O3S+ |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 2-[[3-[[2-[(2,4-dimethyl-1,1-dioxothiazetidin-2-ium-2-yl)methyl]-2,3-dihydro-1H-inden-5-yl]methyl]-5-(trifluoromethyl)phenyl]methylamino]ethanol |
| SMILES | CC1C[N+](C)(CC2Cc3ccc(Cc4cc(CNCCO)cc(C(F)(F)F)c4)cc3C2)S1(=O)=O |
| InChI | InChI=1S/C25H32F3N2O3S/c1-17-15-30(2,34(17,32)33)16-21-10-22-4-3-18(9-23(22)11-21)7-19-8-20(14-29-5-6-31)13-24(12-19)25(26,27)28/h3-4,8-9,12-13,17,21,29,31H,5-7,10-11,14-16H2,1-2H3/q+1 |
| InChIKey | VKSBOWQBOHWEKP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|