About 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine
1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine (PubChem CID 91010763) has the molecular formula C23H19F2NS
and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine |
| PubChem CID | 91010763 |
| Molecular Formula | C23H19F2NS |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine |
| SMILES | Cc1ccc(/N=C(\C=CSc2ccc(C)cc2)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C23H19F2NS/c1-16-3-8-19(9-4-16)26-23(21-12-7-18(24)15-22(21)25)13-14-27-20-10-5-17(2)6-11-20/h3-15H,1-2H3/b14-13?,26-23+ |
| InChIKey | OSVCOZKAZGAKLF-FHMDCDBKSA-N |
| XLogP | 7.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine?
The IUPAC name of 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine (CID 91010763) is 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine.
What is the SMILES notation for 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine?
The canonical SMILES for 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine is Cc1ccc(/N=C(\C=CSc2ccc(C)cc2)c2ccc(F)cc2F)cc1.
What is the InChIKey of 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine?
The InChIKey is OSVCOZKAZGAKLF-FHMDCDBKSA-N. The full InChI is InChI=1S/C23H19F2NS/c1-16-3-8-19(9-4-16)26-23(21-12-7-18(24)15-22(21)25)13-14-27-20-10-5-17(2)6-11-20/h3-15H,1-2H3/b14-13?,26-23+.
What are the key properties of 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine?
1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine has a molecular weight of 379.48 g/mol, XLogP of 7.01, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-N-(4-methylphenyl)-3-(4-methylphenyl)sulfanylprop-2-en-1-imine is sourced from PubChem (CID 91010763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).