C25H36N2O2 — CID 91011114
1-butyl-5-methoxy-3-methyl-N-[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-2-carboxamide (PubChem CID 91011114) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-butyl-5-methoxy-3-methyl-N-[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-2-carboxamide.
| Compound Name | 1-butyl-5-methoxy-3-methyl-N-[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 91011114 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 1-butyl-5-methoxy-3-methyl-N-[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-2-carboxamide |
| SMILES | CCCCn1c(C(=O)NC2C(C)(C)C3CC[C@]2(C)C3)c(C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C25H36N2O2/c1-7-8-13-27-20-10-9-18(29-6)14-19(20)16(2)21(27)22(28)26-23-24(3,4)17-11-12-25(23,5)15-17/h9-10,14,17,23H,7-8,11-13,15H2,1-6H3,(H,26,28)/t17?,23?,25-/m1/s1 |
| InChIKey | LBKVJDWOCYCJAB-KYQMRMBNSA-N |
| XLogP | 5.70 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|