C29H31F3N4O2 — CID 91011144
5-[4-[4-(furan-2-ylmethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]piperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]pentanamide (PubChem CID 91011144) has the molecular formula C29H31F3N4O2 and a molecular weight of 524.59 g/mol. Its IUPAC name is 5-[4-[4-(furan-2-ylmethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]piperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 5-[4-[4-(furan-2-ylmethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]piperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 91011144 |
| Molecular Formula | C29H31F3N4O2 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 5-[4-[4-(furan-2-ylmethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]piperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]pentanamide |
| SMILES | O=C(CCCCN1CCC(c2c[nH]c3nccc(Cc4ccco4)c23)CC1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H31F3N4O2/c30-29(31,32)22-6-8-23(9-7-22)35-26(37)5-1-2-14-36-15-11-20(12-16-36)25-19-34-28-27(25)21(10-13-33-28)18-24-4-3-17-38-24/h3-4,6-10,13,17,19-20H,1-2,5,11-12,14-16,18H2,(H,33,34)(H,35,37) |
| InChIKey | MAYGKPCAQPRZFG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|