C9H16F4O3 — CID 91011456
2-(ethoxymethyl)-4,4,5,5-tetrafluoro-2-methoxypentan-1-ol (PubChem CID 91011456) has the molecular formula C9H16F4O3 and a molecular weight of 248.22 g/mol. Its IUPAC name is 2-(ethoxymethyl)-4,4,5,5-tetrafluoro-2-methoxypentan-1-ol.
| Compound Name | 2-(ethoxymethyl)-4,4,5,5-tetrafluoro-2-methoxypentan-1-ol |
|---|---|
| PubChem CID | 91011456 |
| Molecular Formula | C9H16F4O3 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-(ethoxymethyl)-4,4,5,5-tetrafluoro-2-methoxypentan-1-ol |
| SMILES | CCOCC(CO)(CC(F)(F)C(F)F)OC |
| InChI | InChI=1S/C9H16F4O3/c1-3-16-6-8(5-14,15-2)4-9(12,13)7(10)11/h7,14H,3-6H2,1-2H3 |
| InChIKey | HCIOBTCAXIKNET-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|