About 2-methyl-1,3,5-tris(methylsulfinyl)benzene
2-methyl-1,3,5-tris(methylsulfinyl)benzene (PubChem CID 91011664) has the molecular formula C10H14O3S3
and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-methyl-1,3,5-tris(methylsulfinyl)benzene.
Molecular Properties
| Compound Name | 2-methyl-1,3,5-tris(methylsulfinyl)benzene |
| PubChem CID | 91011664 |
| Molecular Formula | C10H14O3S3 |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 2-methyl-1,3,5-tris(methylsulfinyl)benzene |
| SMILES | Cc1c(S(C)=O)cc(S(C)=O)cc1S(C)=O |
| InChI | InChI=1S/C10H14O3S3/c1-7-9(15(3)12)5-8(14(2)11)6-10(7)16(4)13/h5-6H,1-4H3 |
| InChIKey | VGWJUVMBPNXJAB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1,3,5-tris(methylsulfinyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3,5-tris(methylsulfinyl)benzene?
The IUPAC name of 2-methyl-1,3,5-tris(methylsulfinyl)benzene (CID 91011664) is 2-methyl-1,3,5-tris(methylsulfinyl)benzene.
What is the SMILES notation for 2-methyl-1,3,5-tris(methylsulfinyl)benzene?
The canonical SMILES for 2-methyl-1,3,5-tris(methylsulfinyl)benzene is Cc1c(S(C)=O)cc(S(C)=O)cc1S(C)=O.
What is the InChIKey of 2-methyl-1,3,5-tris(methylsulfinyl)benzene?
The InChIKey is VGWJUVMBPNXJAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3S3/c1-7-9(15(3)12)5-8(14(2)11)6-10(7)16(4)13/h5-6H,1-4H3.
What are the key properties of 2-methyl-1,3,5-tris(methylsulfinyl)benzene?
2-methyl-1,3,5-tris(methylsulfinyl)benzene has a molecular weight of 278.42 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3,5-tris(methylsulfinyl)benzene is sourced from PubChem (CID 91011664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).