About ethane;pyrazolo[1,5-b]pyridazine
ethane;pyrazolo[1,5-b]pyridazine (PubChem CID 91011674) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is ethane;pyrazolo[1,5-b]pyridazine.
Molecular Properties
| Compound Name | ethane;pyrazolo[1,5-b]pyridazine |
| PubChem CID | 91011674 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | ethane;pyrazolo[1,5-b]pyridazine |
| SMILES | CC.c1cnn2nccc2c1 |
| InChI | InChI=1S/C6H5N3.C2H6/c1-2-6-3-5-8-9(6)7-4-1;1-2/h1-5H;1-2H3 |
| InChIKey | NZNDKMOFPOJKFZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;pyrazolo[1,5-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pyrazolo[1,5-b]pyridazine?
The IUPAC name of ethane;pyrazolo[1,5-b]pyridazine (CID 91011674) is ethane;pyrazolo[1,5-b]pyridazine.
What is the SMILES notation for ethane;pyrazolo[1,5-b]pyridazine?
The canonical SMILES for ethane;pyrazolo[1,5-b]pyridazine is CC.c1cnn2nccc2c1.
What is the InChIKey of ethane;pyrazolo[1,5-b]pyridazine?
The InChIKey is NZNDKMOFPOJKFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.C2H6/c1-2-6-3-5-8-9(6)7-4-1;1-2/h1-5H;1-2H3.
What are the key properties of ethane;pyrazolo[1,5-b]pyridazine?
ethane;pyrazolo[1,5-b]pyridazine has a molecular weight of 149.20 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pyrazolo[1,5-b]pyridazine is sourced from PubChem (CID 91011674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).