C32H37FN2O3 — CID 91011919
N-butyl-2-[(4R,6S)-6-[2-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetamide (PubChem CID 91011919) has the molecular formula C32H37FN2O3 and a molecular weight of 516.66 g/mol. Its IUPAC name is N-butyl-2-[(4R,6S)-6-[2-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetamide.
| Compound Name | N-butyl-2-[(4R,6S)-6-[2-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetamide |
|---|---|
| PubChem CID | 91011919 |
| Molecular Formula | C32H37FN2O3 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | N-butyl-2-[(4R,6S)-6-[2-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetamide |
| SMILES | CCCCNC(=O)C[C@H]1C[C@@H](C=Cc2c(C3CC3)nc3ccccc3c2-c2ccc(F)cc2)OC(C)(C)O1 |
| InChI | InChI=1S/C32H37FN2O3/c1-4-5-18-34-29(36)20-25-19-24(37-32(2,3)38-25)16-17-27-30(21-12-14-23(33)15-13-21)26-8-6-7-9-28(26)35-31(27)22-10-11-22/h6-9,12-17,22,24-25H,4-5,10-11,18-20H2,1-3H3,(H,34,36)/t24-,25-/m1/s1 |
| InChIKey | WUZXUHQYLBIRDH-JWQCQUIFSA-N |
| XLogP | 7.15 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|