C13H18F2O4S — CID 91012399
3,4-difluoro-4-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)hexa-1,5-diene-3-sulfonic acid (PubChem CID 91012399) has the molecular formula C13H18F2O4S and a molecular weight of 308.35 g/mol. Its IUPAC name is 3,4-difluoro-4-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)hexa-1,5-diene-3-sulfonic acid.
| Compound Name | 3,4-difluoro-4-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)hexa-1,5-diene-3-sulfonic acid |
|---|---|
| PubChem CID | 91012399 |
| Molecular Formula | C13H18F2O4S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3,4-difluoro-4-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)hexa-1,5-diene-3-sulfonic acid |
| SMILES | C=CC(F)(C1CC2CC1CC2O)C(F)(C=C)S(=O)(=O)O |
| InChI | InChI=1S/C13H18F2O4S/c1-3-12(14,13(15,4-2)20(17,18)19)10-6-9-5-8(10)7-11(9)16/h3-4,8-11,16H,1-2,5-7H2,(H,17,18,19) |
| InChIKey | OBMBGVGVWHUVFQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|