C18H16F3N3O — CID 91012577
7,7-dimethyl-9-(3,4,5-trifluorophenyl)-5,6,8a,9-tetrahydropyrazolo[5,1-b]quinazolin-8-one (PubChem CID 91012577) has the molecular formula C18H16F3N3O and a molecular weight of 347.34 g/mol. Its IUPAC name is 7,7-dimethyl-9-(3,4,5-trifluorophenyl)-5,6,8a,9-tetrahydropyrazolo[5,1-b]quinazolin-8-one.
| Compound Name | 7,7-dimethyl-9-(3,4,5-trifluorophenyl)-5,6,8a,9-tetrahydropyrazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 91012577 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 7,7-dimethyl-9-(3,4,5-trifluorophenyl)-5,6,8a,9-tetrahydropyrazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CCC2=Nc3ccnn3C(c3cc(F)c(F)c(F)c3)C2C1=O |
| InChI | InChI=1S/C18H16F3N3O/c1-18(2)5-3-12-14(17(18)25)16(24-13(23-12)4-6-22-24)9-7-10(19)15(21)11(20)8-9/h4,6-8,14,16H,3,5H2,1-2H3 |
| InChIKey | HGDQRXBEPPRDHR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|