C13H15N — CID 91012593
5,10-dimethyl-4-azabicyclo[6.4.0]dodeca-1(8),4,11-trien-2-yne (PubChem CID 91012593) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 5,10-dimethyl-4-azabicyclo[6.4.0]dodeca-1(8),4,11-trien-2-yne.
| Compound Name | 5,10-dimethyl-4-azabicyclo[6.4.0]dodeca-1(8),4,11-trien-2-yne |
|---|---|
| PubChem CID | 91012593 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5,10-dimethyl-4-azabicyclo[6.4.0]dodeca-1(8),4,11-trien-2-yne |
| SMILES | C/C1=N/C#CC2=C(CC1)CC(C)C=C2 |
| InChI | InChI=1S/C13H15N/c1-10-3-5-12-7-8-14-11(2)4-6-13(12)9-10/h3,5,10H,4,6,9H2,1-2H3/b14-11- |
| InChIKey | MYZYDEIXTFTCIA-KAMYIIQDSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|