C22H28N2O7S3 — CID 91013271
N-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxy)methyl]-5-methyl-3-[4-(methylsulfonylmethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 91013271) has the molecular formula C22H28N2O7S3 and a molecular weight of 528.67 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxy)methyl]-5-methyl-3-[4-(methylsulfonylmethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxy)methyl]-5-methyl-3-[4-(methylsulfonylmethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91013271 |
| Molecular Formula | C22H28N2O7S3 |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | N-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxy)methyl]-5-methyl-3-[4-(methylsulfonylmethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | COCCOC(NS(=O)(=O)c1sc(C)cc1-c1ccc(CS(C)(=O)=O)cc1)c1noc(C)c1C |
| InChI | InChI=1S/C22H28N2O7S3/c1-14-12-19(18-8-6-17(7-9-18)13-33(5,25)26)22(32-14)34(27,28)24-21(30-11-10-29-4)20-15(2)16(3)31-23-20/h6-9,12,21,24H,10-11,13H2,1-5H3 |
| InChIKey | SHJPDHOTSNNXPJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|