About 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine
4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine (PubChem CID 91013340) has the molecular formula C10H14FNO
and a molecular weight of 183.23 g/mol. Its IUPAC name is 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine.
Molecular Properties
| Compound Name | 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine |
| PubChem CID | 91013340 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine |
| SMILES | FC1C=CCC=C1N1CCOCC1 |
| InChI | InChI=1S/C10H14FNO/c11-9-3-1-2-4-10(9)12-5-7-13-8-6-12/h1,3-4,9H,2,5-8H2 |
| InChIKey | VSQKAGLYAIMMGA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine?
The IUPAC name of 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine (CID 91013340) is 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine.
What is the SMILES notation for 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine?
The canonical SMILES for 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine is FC1C=CCC=C1N1CCOCC1.
What is the InChIKey of 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine?
The InChIKey is VSQKAGLYAIMMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNO/c11-9-3-1-2-4-10(9)12-5-7-13-8-6-12/h1,3-4,9H,2,5-8H2.
What are the key properties of 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine?
4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine has a molecular weight of 183.23 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-fluorocyclohexa-1,4-dien-1-yl)morpholine is sourced from PubChem (CID 91013340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).