C18H28O4S — CID 91013427
1-[3-(2-hydroxy-2-propylpentyl)sulfonylphenyl]butan-1-one (PubChem CID 91013427) has the molecular formula C18H28O4S and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-[3-(2-hydroxy-2-propylpentyl)sulfonylphenyl]butan-1-one.
| Compound Name | 1-[3-(2-hydroxy-2-propylpentyl)sulfonylphenyl]butan-1-one |
|---|---|
| PubChem CID | 91013427 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-[3-(2-hydroxy-2-propylpentyl)sulfonylphenyl]butan-1-one |
| SMILES | CCCC(=O)c1cccc(S(=O)(=O)CC(O)(CCC)CCC)c1 |
| InChI | InChI=1S/C18H28O4S/c1-4-8-17(19)15-9-7-10-16(13-15)23(21,22)14-18(20,11-5-2)12-6-3/h7,9-10,13,20H,4-6,8,11-12,14H2,1-3H3 |
| InChIKey | KYLRGLLHLIYLAT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |