About 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane
5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane (PubChem CID 91013647) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane.
Molecular Properties
| Compound Name | 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane |
| PubChem CID | 91013647 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane |
| SMILES | C1=NC2CCCC2N=C1.CC |
| InChI | InChI=1S/C7H10N2.C2H6/c1-2-6-7(3-1)9-5-4-8-6;1-2/h4-7H,1-3H2;1-2H3 |
| InChIKey | ULZBUHILDBRPHK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane?
The IUPAC name of 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane (CID 91013647) is 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane.
What is the SMILES notation for 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane?
The canonical SMILES for 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane is C1=NC2CCCC2N=C1.CC.
What is the InChIKey of 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane?
The InChIKey is ULZBUHILDBRPHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C2H6/c1-2-6-7(3-1)9-5-4-8-6;1-2/h4-7H,1-3H2;1-2H3.
What are the key properties of 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane?
5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane has a molecular weight of 152.24 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine;ethane is sourced from PubChem (CID 91013647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).