C11H22F5NO6S2 — CID 91013718
azanium 3-methyl-5-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropoxymethyl)pentane-1-sulfonate (PubChem CID 91013718) has the molecular formula C11H22F5NO6S2 and a molecular weight of 423.42 g/mol. Its IUPAC name is azanium 3-methyl-5-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropoxymethyl)pentane-1-sulfonate.
| Compound Name | azanium 3-methyl-5-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropoxymethyl)pentane-1-sulfonate |
|---|---|
| PubChem CID | 91013718 |
| Molecular Formula | C11H22F5NO6S2 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | azanium 3-methyl-5-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropoxymethyl)pentane-1-sulfonate |
| SMILES | CC(CCS(C)(=O)=O)(CCS(=O)(=O)[O-])COCC(F)(F)C(F)(F)F.[NH4+] |
| InChI | InChI=1S/C11H19F5O6S2.H3N/c1-9(3-5-23(2,17)18,4-6-24(19,20)21)7-22-8-10(12,13)11(14,15)16;/h3-8H2,1-2H3,(H,19,20,21);1H3 |
| InChIKey | ZDVBTUGFCPUNAH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|