C18H26N4O4 — CID 91014511
(2S)-2-amino-6-[(2,3-dihydroxy-4-quinoxalin-2-ylbutyl)amino]hexanoic acid (PubChem CID 91014511) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2S)-2-amino-6-[(2,3-dihydroxy-4-quinoxalin-2-ylbutyl)amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(2,3-dihydroxy-4-quinoxalin-2-ylbutyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 91014511 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (2S)-2-amino-6-[(2,3-dihydroxy-4-quinoxalin-2-ylbutyl)amino]hexanoic acid |
| SMILES | N[C@@H](CCCCNCC(O)C(O)Cc1cnc2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C18H26N4O4/c19-13(18(25)26)5-3-4-8-20-11-17(24)16(23)9-12-10-21-14-6-1-2-7-15(14)22-12/h1-2,6-7,10,13,16-17,20,23-24H,3-5,8-9,11,19H2,(H,25,26)/t13-,16?,17?/m0/s1 |
| InChIKey | XVNHBPYQSRFDEP-IGEOTXOUSA-N |
| XLogP | 0.07 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|