C31H28N6O2 — CID 91014727
N-[[4-(dimethylamino)phenyl]methyl]-4-[[5-(1-hydroxy-2H-isoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzamide (PubChem CID 91014727) has the molecular formula C31H28N6O2 and a molecular weight of 516.61 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-4-[[5-(1-hydroxy-2H-isoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-4-[[5-(1-hydroxy-2H-isoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzamide |
|---|---|
| PubChem CID | 91014727 |
| Molecular Formula | C31H28N6O2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-4-[[5-(1-hydroxy-2H-isoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2ccc(Nc3ccc(-c4ccc5c(O)[nH]cc5c4)n4ccnc34)cc2)cc1 |
| InChI | InChI=1S/C31H28N6O2/c1-36(2)25-10-3-20(4-11-25)18-33-30(38)21-5-8-24(9-6-21)35-27-13-14-28(37-16-15-32-29(27)37)22-7-12-26-23(17-22)19-34-31(26)39/h3-17,19,34-35,39H,18H2,1-2H3,(H,33,38) |
| InChIKey | UGXFOGKZNUOBMJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|