About ethane;1,3,4,4-tetramethyl-2H-quinazoline
ethane;1,3,4,4-tetramethyl-2H-quinazoline (PubChem CID 91014765) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;1,3,4,4-tetramethyl-2H-quinazoline.
Molecular Properties
| Compound Name | ethane;1,3,4,4-tetramethyl-2H-quinazoline |
| PubChem CID | 91014765 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | ethane;1,3,4,4-tetramethyl-2H-quinazoline |
| SMILES | CC.CN1CN(C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C12H18N2.C2H6/c1-12(2)10-7-5-6-8-11(10)13(3)9-14(12)4;1-2/h5-8H,9H2,1-4H3;1-2H3 |
| InChIKey | RMLRCMYZNBQXAR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1,3,4,4-tetramethyl-2H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,3,4,4-tetramethyl-2H-quinazoline?
The IUPAC name of ethane;1,3,4,4-tetramethyl-2H-quinazoline (CID 91014765) is ethane;1,3,4,4-tetramethyl-2H-quinazoline.
What is the SMILES notation for ethane;1,3,4,4-tetramethyl-2H-quinazoline?
The canonical SMILES for ethane;1,3,4,4-tetramethyl-2H-quinazoline is CC.CN1CN(C)C(C)(C)c2ccccc21.
What is the InChIKey of ethane;1,3,4,4-tetramethyl-2H-quinazoline?
The InChIKey is RMLRCMYZNBQXAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2.C2H6/c1-12(2)10-7-5-6-8-11(10)13(3)9-14(12)4;1-2/h5-8H,9H2,1-4H3;1-2H3.
What are the key properties of ethane;1,3,4,4-tetramethyl-2H-quinazoline?
ethane;1,3,4,4-tetramethyl-2H-quinazoline has a molecular weight of 220.36 g/mol, XLogP of 3.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,3,4,4-tetramethyl-2H-quinazoline is sourced from PubChem (CID 91014765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).