About 8-butyl-1,3-dimethylbicyclo[7.1.0]decane
8-butyl-1,3-dimethylbicyclo[7.1.0]decane (PubChem CID 91015079) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is 8-butyl-1,3-dimethylbicyclo[7.1.0]decane.
Molecular Properties
| Compound Name | 8-butyl-1,3-dimethylbicyclo[7.1.0]decane |
| PubChem CID | 91015079 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 8-butyl-1,3-dimethylbicyclo[7.1.0]decane |
| SMILES | CCCCC1CCCCC(C)CC2(C)CC12 |
| InChI | InChI=1S/C16H30/c1-4-5-9-14-10-7-6-8-13(2)11-16(3)12-15(14)16/h13-15H,4-12H2,1-3H3 |
| InChIKey | RQFCCSAAADHXIL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 8-butyl-1,3-dimethylbicyclo[7.1.0]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-butyl-1,3-dimethylbicyclo[7.1.0]decane?
The IUPAC name of 8-butyl-1,3-dimethylbicyclo[7.1.0]decane (CID 91015079) is 8-butyl-1,3-dimethylbicyclo[7.1.0]decane.
What is the SMILES notation for 8-butyl-1,3-dimethylbicyclo[7.1.0]decane?
The canonical SMILES for 8-butyl-1,3-dimethylbicyclo[7.1.0]decane is CCCCC1CCCCC(C)CC2(C)CC12.
What is the InChIKey of 8-butyl-1,3-dimethylbicyclo[7.1.0]decane?
The InChIKey is RQFCCSAAADHXIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30/c1-4-5-9-14-10-7-6-8-13(2)11-16(3)12-15(14)16/h13-15H,4-12H2,1-3H3.
What are the key properties of 8-butyl-1,3-dimethylbicyclo[7.1.0]decane?
8-butyl-1,3-dimethylbicyclo[7.1.0]decane has a molecular weight of 222.42 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-butyl-1,3-dimethylbicyclo[7.1.0]decane is sourced from PubChem (CID 91015079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).