C12H18FN — CID 91015106
2-(2,2-dimethylpropyl)-4-fluoro-6-methyl-3H-azepine (PubChem CID 91015106) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-4-fluoro-6-methyl-3H-azepine.
| Compound Name | 2-(2,2-dimethylpropyl)-4-fluoro-6-methyl-3H-azepine |
|---|---|
| PubChem CID | 91015106 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-4-fluoro-6-methyl-3H-azepine |
| SMILES | CC1=CN=C(CC(C)(C)C)CC(F)=C1 |
| InChI | InChI=1S/C12H18FN/c1-9-5-10(13)6-11(14-8-9)7-12(2,3)4/h5,8H,6-7H2,1-4H3 |
| InChIKey | MTRWTKLRBYIJAQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |