About 1-(2,6-dimethylphenyl)pyrrole-2,5-diol
1-(2,6-dimethylphenyl)pyrrole-2,5-diol (PubChem CID 91015148) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-(2,6-dimethylphenyl)pyrrole-2,5-diol |
| PubChem CID | 91015148 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 1-(2,6-dimethylphenyl)pyrrole-2,5-diol |
| SMILES | Cc1cccc(C)c1-n1c(O)ccc1O |
| InChI | InChI=1S/C12H13NO2/c1-8-4-3-5-9(2)12(8)13-10(14)6-7-11(13)15/h3-7,14-15H,1-2H3 |
| InChIKey | NYUJJAVZWDNBBD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,6-dimethylphenyl)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylphenyl)pyrrole-2,5-diol?
The IUPAC name of 1-(2,6-dimethylphenyl)pyrrole-2,5-diol (CID 91015148) is 1-(2,6-dimethylphenyl)pyrrole-2,5-diol.
What is the SMILES notation for 1-(2,6-dimethylphenyl)pyrrole-2,5-diol?
The canonical SMILES for 1-(2,6-dimethylphenyl)pyrrole-2,5-diol is Cc1cccc(C)c1-n1c(O)ccc1O.
What is the InChIKey of 1-(2,6-dimethylphenyl)pyrrole-2,5-diol?
The InChIKey is NYUJJAVZWDNBBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-8-4-3-5-9(2)12(8)13-10(14)6-7-11(13)15/h3-7,14-15H,1-2H3.
What are the key properties of 1-(2,6-dimethylphenyl)pyrrole-2,5-diol?
1-(2,6-dimethylphenyl)pyrrole-2,5-diol has a molecular weight of 203.24 g/mol, XLogP of 2.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylphenyl)pyrrole-2,5-diol is sourced from PubChem (CID 91015148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).