C19H28O4 — CID 91015295
(10R,13S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-6,7-dione (PubChem CID 91015295) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (10R,13S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-6,7-dione.
| Compound Name | (10R,13S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-6,7-dione |
|---|---|
| PubChem CID | 91015295 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (10R,13S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-6,7-dione |
| SMILES | C[C@]12CCC(O)CC1C(=O)C(=O)C1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C19H28O4/c1-18-7-5-10(20)9-13(18)16(22)17(23)15-11-3-4-14(21)19(11,2)8-6-12(15)18/h10-15,20-21H,3-9H2,1-2H3/t10?,11?,12?,13?,14-,15?,18+,19-/m0/s1 |
| InChIKey | COAFHWISZKWHBX-NNIPAMOWSA-N |
| XLogP | 2.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|