C20H36N8O6 — CID 91015545
1,4-bis[1-formamido-1-[(2-methylpropan-2-yl)oxy]ethyl]-3,6-diiminopiperazine-2,5-dicarboxamide (PubChem CID 91015545) has the molecular formula C20H36N8O6 and a molecular weight of 484.56 g/mol. Its IUPAC name is 1,4-bis[1-formamido-1-[(2-methylpropan-2-yl)oxy]ethyl]-3,6-diiminopiperazine-2,5-dicarboxamide.
| Compound Name | 1,4-bis[1-formamido-1-[(2-methylpropan-2-yl)oxy]ethyl]-3,6-diiminopiperazine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 91015545 |
| Molecular Formula | C20H36N8O6 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 1,4-bis[1-formamido-1-[(2-methylpropan-2-yl)oxy]ethyl]-3,6-diiminopiperazine-2,5-dicarboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)N(C(C)(NC=O)OC(C)(C)C)/C(=N/[H])C(C(N)=O)N1C(C)(NC=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36N8O6/c1-17(2,3)33-19(7,25-9-29)27-11(15(23)31)14(22)28(12(13(27)21)16(24)32)20(8,26-10-30)34-18(4,5)6/h9-12,21-22H,1-8H3,(H2,23,31)(H2,24,32)(H,25,29)(H,26,30)/b21-13+,22-14+ |
| InChIKey | JEFYQJWGSJMULO-JFMUQQRKSA-N |
| XLogP | -1.26 |
| TPSA | 217.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|