C22H18N2O3 — CID 91015843
7-[(1S,7R,8R,11S)-3,5-dihydroxy-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraen-4-yl]-4-methyl-1H-quinolin-2-one (PubChem CID 91015843) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 7-[(1S,7R,8R,11S)-3,5-dihydroxy-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraen-4-yl]-4-methyl-1H-quinolin-2-one.
| Compound Name | 7-[(1S,7R,8R,11S)-3,5-dihydroxy-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraen-4-yl]-4-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 91015843 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 7-[(1S,7R,8R,11S)-3,5-dihydroxy-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraen-4-yl]-4-methyl-1H-quinolin-2-one |
| SMILES | Cc1cc(=O)[nH]c2cc(-n3c(O)c4c(c3O)[C@@H]3C=C[C@H]4[C@H]4C=C[C@H]43)ccc12 |
| InChI | InChI=1S/C22H18N2O3/c1-10-8-18(25)23-17-9-11(2-3-12(10)17)24-21(26)19-15-6-7-16(20(19)22(24)27)14-5-4-13(14)15/h2-9,13-16,26-27H,1H3,(H,23,25)/t13-,14+,15-,16+ |
| InChIKey | SEQRIVNGNKMVGV-GEEKYZPCSA-N |
| XLogP | 3.59 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|