About methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate
methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate (PubChem CID 91015876) has the molecular formula C18H15ClN2O3
and a molecular weight of 342.78 g/mol. Its IUPAC name is methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate |
| PubChem CID | 91015876 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc2c(cc1C)NC(=O)c1ccc(Cl)cc1N2 |
| InChI | InChI=1S/C18H15ClN2O3/c1-10-7-15-16(8-11(10)3-6-17(22)24-2)20-14-9-12(19)4-5-13(14)18(23)21-15/h3-9,20H,1-2H3,(H,21,23) |
| InChIKey | FSOFSCISDVCADW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate?
The IUPAC name of methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate (CID 91015876) is methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate.
What is the SMILES notation for methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate?
The canonical SMILES for methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate is COC(=O)C=Cc1cc2c(cc1C)NC(=O)c1ccc(Cl)cc1N2.
What is the InChIKey of methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate?
The InChIKey is FSOFSCISDVCADW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O3/c1-10-7-15-16(8-11(10)3-6-17(22)24-2)20-14-9-12(19)4-5-13(14)18(23)21-15/h3-9,20H,1-2H3,(H,21,23).
What are the key properties of methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate?
methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate has a molecular weight of 342.78 g/mol, XLogP of 4.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate is sourced from PubChem (CID 91015876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).