C18H15ClN2O3 — CID 91015876
methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate (PubChem CID 91015876) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate.
| Compound Name | methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 91015876 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | methyl 3-(9-chloro-3-methyl-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc2c(cc1C)NC(=O)c1ccc(Cl)cc1N2 |
| InChI | InChI=1S/C18H15ClN2O3/c1-10-7-15-16(8-11(10)3-6-17(22)24-2)20-14-9-12(19)4-5-13(14)18(23)21-15/h3-9,20H,1-2H3,(H,21,23) |
| InChIKey | FSOFSCISDVCADW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|