C26H30N4O8 — CID 91015998
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) N-[6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonylamino]hexyl]carbamate (PubChem CID 91015998) has the molecular formula C26H30N4O8 and a molecular weight of 526.55 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) N-[6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonylamino]hexyl]carbamate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) N-[6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 91015998 |
| Molecular Formula | C26H30N4O8 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) N-[6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonylamino]hexyl]carbamate |
| SMILES | O=C(NCCCCCCNC(=O)On1c(O)c2c(c1O)C1C=CC2C1)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C26H30N4O8/c31-21-17-13-5-6-14(11-13)18(17)22(32)29(21)37-25(35)27-9-3-1-2-4-10-28-26(36)38-30-23(33)19-15-7-8-16(12-15)20(19)24(30)34/h5-8,13-16,31-34H,1-4,9-12H2,(H,27,35)(H,28,36) |
| InChIKey | LSEPUAOWRUZPEY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 167.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|