C15H23F3S — CID 91016548
10-ethylsulfanyl-3,8-dimethyl-6-(trifluoromethyl)deca-3,4,5-triene (PubChem CID 91016548) has the molecular formula C15H23F3S and a molecular weight of 292.41 g/mol. Its IUPAC name is 10-ethylsulfanyl-3,8-dimethyl-6-(trifluoromethyl)deca-3,4,5-triene.
| Compound Name | 10-ethylsulfanyl-3,8-dimethyl-6-(trifluoromethyl)deca-3,4,5-triene |
|---|---|
| PubChem CID | 91016548 |
| Molecular Formula | C15H23F3S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 10-ethylsulfanyl-3,8-dimethyl-6-(trifluoromethyl)deca-3,4,5-triene |
| SMILES | CCSCCC(C)CC(=C=C=C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C15H23F3S/c1-5-12(3)7-8-14(15(16,17)18)11-13(4)9-10-19-6-2/h13H,5-6,9-11H2,1-4H3/b14-12- |
| InChIKey | JGDGRYWYVPXIKS-OWBHPGMISA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|