C20H36O3 — CID 91016735
2-(2-cyclopent-2-en-1-yl-3,3-dimethylbutan-2-yl)-2-hydroxy-3,3,4,4-tetramethylpentanoic acid (PubChem CID 91016735) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-(2-cyclopent-2-en-1-yl-3,3-dimethylbutan-2-yl)-2-hydroxy-3,3,4,4-tetramethylpentanoic acid.
| Compound Name | 2-(2-cyclopent-2-en-1-yl-3,3-dimethylbutan-2-yl)-2-hydroxy-3,3,4,4-tetramethylpentanoic acid |
|---|---|
| PubChem CID | 91016735 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 2-(2-cyclopent-2-en-1-yl-3,3-dimethylbutan-2-yl)-2-hydroxy-3,3,4,4-tetramethylpentanoic acid |
| SMILES | CC(C)(C)C(C)(C)C(O)(C(=O)O)C(C)(C1C=CCC1)C(C)(C)C |
| InChI | InChI=1S/C20H36O3/c1-16(2,3)18(7,8)20(23,15(21)22)19(9,17(4,5)6)14-12-10-11-13-14/h10,12,14,23H,11,13H2,1-9H3,(H,21,22) |
| InChIKey | VVEPOLYDXIFGMN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|