About 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate
1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate (PubChem CID 91018179) has the molecular formula C26H46O2
and a molecular weight of 390.65 g/mol. Its IUPAC name is 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate |
| PubChem CID | 91018179 |
| Molecular Formula | C26H46O2 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate |
| SMILES | CCC(C(C)C)C1(C(=O)OC(C)(C2CCCCC2)C2CCCCC2)CC1(C)C |
| InChI | InChI=1S/C26H46O2/c1-7-22(19(2)3)26(18-24(26,4)5)23(27)28-25(6,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h19-22H,7-18H2,1-6H3 |
| InChIKey | SGUXVQKHWUKMKK-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate?
The IUPAC name of 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate (CID 91018179) is 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate.
What is the SMILES notation for 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate?
The canonical SMILES for 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate is CCC(C(C)C)C1(C(=O)OC(C)(C2CCCCC2)C2CCCCC2)CC1(C)C.
What is the InChIKey of 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate?
The InChIKey is SGUXVQKHWUKMKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H46O2/c1-7-22(19(2)3)26(18-24(26,4)5)23(27)28-25(6,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h19-22H,7-18H2,1-6H3.
What are the key properties of 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate?
1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate has a molecular weight of 390.65 g/mol, XLogP of 7.55, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dicyclohexylethyl 2,2-dimethyl-1-(2-methylpentan-3-yl)cyclopropane-1-carboxylate is sourced from PubChem (CID 91018179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).