C16H16Cl2N6O3 — CID 91018410
8-[[2-(4-amino-3,5-dichlorophenyl)-2-oxoethyl]amino]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 91018410) has the molecular formula C16H16Cl2N6O3 and a molecular weight of 411.25 g/mol. Its IUPAC name is 8-[[2-(4-amino-3,5-dichlorophenyl)-2-oxoethyl]amino]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-oxoethyl]amino]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 91018410 |
| Molecular Formula | C16H16Cl2N6O3 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-oxoethyl]amino]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NCC(=O)c3cc(Cl)c(N)c(Cl)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H16Cl2N6O3/c1-22-12-13(23(2)16(27)24(3)14(12)26)21-15(22)20-6-10(25)7-4-8(17)11(19)9(18)5-7/h4-5H,6,19H2,1-3H3,(H,20,21) |
| InChIKey | DOKSFFAYYHQFPL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|