C19H19N3O4 — CID 91018455
(8R)-5-(3,5-dimethyl-4-nitrophenyl)-8-methyl-8,9-dihydro-5H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine (PubChem CID 91018455) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is (8R)-5-(3,5-dimethyl-4-nitrophenyl)-8-methyl-8,9-dihydro-5H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine.
| Compound Name | (8R)-5-(3,5-dimethyl-4-nitrophenyl)-8-methyl-8,9-dihydro-5H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine |
|---|---|
| PubChem CID | 91018455 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (8R)-5-(3,5-dimethyl-4-nitrophenyl)-8-methyl-8,9-dihydro-5H-[1,3]dioxolo[4,5-h][2,3]benzodiazepine |
| SMILES | Cc1cc(C2N=N[C@H](C)Cc3cc4c(cc32)OCO4)cc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O4/c1-10-4-14(5-11(2)19(10)22(23)24)18-15-8-17-16(25-9-26-17)7-13(15)6-12(3)20-21-18/h4-5,7-8,12,18H,6,9H2,1-3H3/t12-,18?/m1/s1 |
| InChIKey | DDNFPSFOANWZRZ-GKOGFXNCSA-N |
| XLogP | 4.43 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|