C27H19BrF3N3O2S — CID 91018844
4-bromo-14-hydroxy-10-(4-methoxyphenyl)-13-[4-(trifluoromethyl)phenyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,14-pentaene-12-thione (PubChem CID 91018844) has the molecular formula C27H19BrF3N3O2S and a molecular weight of 586.43 g/mol. Its IUPAC name is 4-bromo-14-hydroxy-10-(4-methoxyphenyl)-13-[4-(trifluoromethyl)phenyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,14-pentaene-12-thione.
| Compound Name | 4-bromo-14-hydroxy-10-(4-methoxyphenyl)-13-[4-(trifluoromethyl)phenyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,14-pentaene-12-thione |
|---|---|
| PubChem CID | 91018844 |
| Molecular Formula | C27H19BrF3N3O2S |
| Molecular Weight | 586.43 g/mol |
| Exact Mass | 585.03 |
| IUPAC Name | 4-bromo-14-hydroxy-10-(4-methoxyphenyl)-13-[4-(trifluoromethyl)phenyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,14-pentaene-12-thione |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Br)cc4c3Cc3c(O)n(-c4ccc(C(F)(F)F)cc4)c(=S)n32)cc1 |
| InChI | InChI=1S/C27H19BrF3N3O2S/c1-36-18-9-2-14(3-10-18)24-23-20(19-12-16(28)6-11-21(19)32-23)13-22-25(35)33(26(37)34(22)24)17-7-4-15(5-8-17)27(29,30)31/h2-12,24,32,35H,13H2,1H3 |
| InChIKey | NEEZPYXSAPWZKU-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.43 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|