C17H28N4O4S — CID 91018883
(2R)-2-ethyl-3-[4-(4-propan-2-ylsulfonylpiperazin-1-yl)pyrimidin-2-yl]butanoic acid (PubChem CID 91018883) has the molecular formula C17H28N4O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is (2R)-2-ethyl-3-[4-(4-propan-2-ylsulfonylpiperazin-1-yl)pyrimidin-2-yl]butanoic acid.
| Compound Name | (2R)-2-ethyl-3-[4-(4-propan-2-ylsulfonylpiperazin-1-yl)pyrimidin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 91018883 |
| Molecular Formula | C17H28N4O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2R)-2-ethyl-3-[4-(4-propan-2-ylsulfonylpiperazin-1-yl)pyrimidin-2-yl]butanoic acid |
| SMILES | CC[C@@H](C(=O)O)C(C)c1nccc(N2CCN(S(=O)(=O)C(C)C)CC2)n1 |
| InChI | InChI=1S/C17H28N4O4S/c1-5-14(17(22)23)13(4)16-18-7-6-15(19-16)20-8-10-21(11-9-20)26(24,25)12(2)3/h6-7,12-14H,5,8-11H2,1-4H3,(H,22,23)/t13?,14-/m1/s1 |
| InChIKey | CDTNYVKRZFWSFV-ARLHGKGLSA-N |
| XLogP | 1.55 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |