About [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid
[(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid (PubChem CID 91019033) has the molecular formula C4H10NO4P
and a molecular weight of 167.10 g/mol. Its IUPAC name is [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid.
Molecular Properties
| Compound Name | [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid |
| PubChem CID | 91019033 |
| Molecular Formula | C4H10NO4P |
| Molecular Weight | 167.10 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid |
| SMILES | O=P(O)(O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C4H10NO4P/c6-3-1-4(5-2-3)10(7,8)9/h3-6H,1-2H2,(H2,7,8,9)/t3-,4-/m1/s1 |
| InChIKey | VXFOAMZWHIQQRW-QWWZWVQMSA-N |
| XLogP | -1.16 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.10 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid?
The IUPAC name of [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid (CID 91019033) is [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid.
What is the SMILES notation for [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid?
The canonical SMILES for [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid is O=P(O)(O)[C@@H]1C[C@@H](O)CN1.
What is the InChIKey of [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid?
The InChIKey is VXFOAMZWHIQQRW-QWWZWVQMSA-N. The full InChI is InChI=1S/C4H10NO4P/c6-3-1-4(5-2-3)10(7,8)9/h3-6H,1-2H2,(H2,7,8,9)/t3-,4-/m1/s1.
What are the key properties of [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid?
[(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid has a molecular weight of 167.10 g/mol, XLogP of -1.16, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4R)-4-hydroxypyrrolidin-2-yl]phosphonic acid is sourced from PubChem (CID 91019033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).