C11H18N2 — CID 91019224
2-methyl-5-piperidin-4-yl-3,4-dihydropyridine (PubChem CID 91019224) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-methyl-5-piperidin-4-yl-3,4-dihydropyridine.
| Compound Name | 2-methyl-5-piperidin-4-yl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 91019224 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-methyl-5-piperidin-4-yl-3,4-dihydropyridine |
| SMILES | CC1=NC=C(C2CCNCC2)CC1 |
| InChI | InChI=1S/C11H18N2/c1-9-2-3-11(8-13-9)10-4-6-12-7-5-10/h8,10,12H,2-7H2,1H3 |
| InChIKey | GWQUWXGIZHSFDI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |