C10H10N2O5 — CID 91019258
1-[2-(2,5-dihydroxypyrrol-1-yl)oxyethyl]pyrrole-2,5-dione (PubChem CID 91019258) has the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. Its IUPAC name is 1-[2-(2,5-dihydroxypyrrol-1-yl)oxyethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(2,5-dihydroxypyrrol-1-yl)oxyethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 91019258 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-[2-(2,5-dihydroxypyrrol-1-yl)oxyethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCOn1c(O)ccc1O |
| InChI | InChI=1S/C10H10N2O5/c13-7-1-2-8(14)11(7)5-6-17-12-9(15)3-4-10(12)16/h1-4,15-16H,5-6H2 |
| InChIKey | VDOUHDOHRPMPDG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|