C9H15ClN2 — CID 91019306
4-chloro-6-methylidene-2,3,4,4a,5,7,8,8a-octahydro-1H-quinazoline (PubChem CID 91019306) has the molecular formula C9H15ClN2 and a molecular weight of 186.69 g/mol. Its IUPAC name is 4-chloro-6-methylidene-2,3,4,4a,5,7,8,8a-octahydro-1H-quinazoline.
| Compound Name | 4-chloro-6-methylidene-2,3,4,4a,5,7,8,8a-octahydro-1H-quinazoline |
|---|---|
| PubChem CID | 91019306 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-chloro-6-methylidene-2,3,4,4a,5,7,8,8a-octahydro-1H-quinazoline |
| SMILES | C=C1CCC2NCNC(Cl)C2C1 |
| InChI | InChI=1S/C9H15ClN2/c1-6-2-3-8-7(4-6)9(10)12-5-11-8/h7-9,11-12H,1-5H2 |
| InChIKey | GAMUMNPNNKLEKQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|