About 2-methoxyethylideneurea
2-methoxyethylideneurea (PubChem CID 91020295) has the molecular formula C4H8N2O2
and a molecular weight of 116.12 g/mol. Its IUPAC name is 2-methoxyethylideneurea.
Molecular Properties
| Compound Name | 2-methoxyethylideneurea |
| PubChem CID | 91020295 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 2-methoxyethylideneurea |
| SMILES | COCC=NC(N)=O |
| InChI | InChI=1S/C4H8N2O2/c1-8-3-2-6-4(5)7/h2H,3H2,1H3,(H2,5,7) |
| InChIKey | MTYRTUAKOBAELT-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethylideneurea?
The IUPAC name of 2-methoxyethylideneurea (CID 91020295) is 2-methoxyethylideneurea.
What is the SMILES notation for 2-methoxyethylideneurea?
The canonical SMILES for 2-methoxyethylideneurea is COCC=NC(N)=O.
What is the InChIKey of 2-methoxyethylideneurea?
The InChIKey is MTYRTUAKOBAELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2/c1-8-3-2-6-4(5)7/h2H,3H2,1H3,(H2,5,7).
What are the key properties of 2-methoxyethylideneurea?
2-methoxyethylideneurea has a molecular weight of 116.12 g/mol, XLogP of -0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethylideneurea is sourced from PubChem (CID 91020295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).