About Pyrazolopyrimidine derivative 39
Pyrazolopyrimidine derivative 39 (PubChem CID 91020834) has the molecular formula C20H18N6O3S
and a molecular weight of 422.50 g/mol. Its IUPAC name is [1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-[(3-methylsulfonylphenyl)methyl]diazene.
Molecular Properties
| Compound Name | Pyrazolopyrimidine derivative 39 |
| PubChem CID | 91020834 |
| Molecular Formula | C20H18N6O3S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | [1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-[(3-methylsulfonylphenyl)methyl]diazene |
| SMILES | COC1=CC=CC(=C1)N2C3=NC=NC(=C3C=N2)N=NCC4=CC(=CC=C4)S(=O)(=O)C |
| InChI | InChI=1S/C20H18N6O3S/c1-29-16-7-4-6-15(10-16)26-20-18(12-24-26)19(21-13-22-20)25-23-11-14-5-3-8-17(9-14)30(2,27)28/h3-10,12-13H,11H2,1-2H3 |
| InChIKey | NZBIDKMWCLSREQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 120.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | 699 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze Pyrazolopyrimidine derivative 39 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pyrazolopyrimidine derivative 39?
The IUPAC name of Pyrazolopyrimidine derivative 39 (CID 91020834) is [1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-[(3-methylsulfonylphenyl)methyl]diazene.
What is the SMILES notation for Pyrazolopyrimidine derivative 39?
The canonical SMILES for Pyrazolopyrimidine derivative 39 is COC1=CC=CC(=C1)N2C3=NC=NC(=C3C=N2)N=NCC4=CC(=CC=C4)S(=O)(=O)C.
What is the InChIKey of Pyrazolopyrimidine derivative 39?
The InChIKey is NZBIDKMWCLSREQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N6O3S/c1-29-16-7-4-6-15(10-16)26-20-18(12-24-26)19(21-13-22-20)25-23-11-14-5-3-8-17(9-14)30(2,27)28/h3-10,12-13H,11H2,1-2H3.
What are the key properties of Pyrazolopyrimidine derivative 39?
Pyrazolopyrimidine derivative 39 has a molecular weight of 422.50 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Pyrazolopyrimidine derivative 39 is sourced from PubChem (CID 91020834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).