C36H53Cl2NO7 — CID 91021101
12-[7-[(2,4-dichlorophenyl)methylamino]-6-hydroxy-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4,7-dihydroxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 91021101) has the molecular formula C36H53Cl2NO7 and a molecular weight of 682.73 g/mol. Its IUPAC name is 12-[7-[(2,4-dichlorophenyl)methylamino]-6-hydroxy-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4,7-dihydroxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | 12-[7-[(2,4-dichlorophenyl)methylamino]-6-hydroxy-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4,7-dihydroxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 91021101 |
| Molecular Formula | C36H53Cl2NO7 |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | 12-[7-[(2,4-dichlorophenyl)methylamino]-6-hydroxy-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4,7-dihydroxy-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | CCC(OC)C(C)C1OC1C(NCc1ccc(Cl)cc1Cl)C(C)(O)C=CC=C(C)C1OC(=O)CC(O)CCC(C)(O)CC=CC1C |
| InChI | InChI=1S/C36H53Cl2NO7/c1-8-29(44-7)24(4)32-33(46-32)34(39-21-25-13-14-26(37)19-28(25)38)36(6,43)17-10-12-23(3)31-22(2)11-9-16-35(5,42)18-15-27(40)20-30(41)45-31/h9-14,17,19,22,24,27,29,31-34,39-40,42-43H,8,15-16,18,20-21H2,1-7H3 |
| InChIKey | RKCZWUWPKBRXBT-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|